C12H14F3NO2 — CID 69487497
tert-butyl N-phenyl-N-(trifluoromethyl)carbamate (PubChem CID 69487497) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is tert-butyl N-phenyl-N-(trifluoromethyl)carbamate.
| Compound Name | tert-butyl N-phenyl-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 69487497 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | tert-butyl N-phenyl-N-(trifluoromethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2/c1-11(2,3)18-10(17)16(12(13,14)15)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | JZSVFMCORWKUOK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|