C11H14FNO3 — CID 87378206
tert-butyl N-fluoro-N-(4-hydroxyphenyl)carbamate (PubChem CID 87378206) has the molecular formula C11H14FNO3 and a molecular weight of 227.24 g/mol. Its IUPAC name is tert-butyl N-fluoro-N-(4-hydroxyphenyl)carbamate.
| Compound Name | tert-butyl N-fluoro-N-(4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 87378206 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | tert-butyl N-fluoro-N-(4-hydroxyphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(F)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14FNO3/c1-11(2,3)16-10(15)13(12)8-4-6-9(14)7-5-8/h4-7,14H,1-3H3 |
| InChIKey | PTJPFIQWGKVJCN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|