C39H48N6O6 — CID 102187327
tert-butyl N-[3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylhydrazinyl]anilino]-N-phenylcarbamate (PubChem CID 102187327) has the molecular formula C39H48N6O6 and a molecular weight of 696.85 g/mol. Its IUPAC name is tert-butyl N-[3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylhydrazinyl]anilino]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylhydrazinyl]anilino]-N-phenylcarbamate |
|---|---|
| PubChem CID | 102187327 |
| Molecular Formula | C39H48N6O6 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | tert-butyl N-[3,5-bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenylhydrazinyl]anilino]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Nc1cc(NN(C(=O)OC(C)(C)C)c2ccccc2)cc(NN(C(=O)OC(C)(C)C)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C39H48N6O6/c1-37(2,3)49-34(46)43(31-19-13-10-14-20-31)40-28-25-29(41-44(32-21-15-11-16-22-32)35(47)50-38(4,5)6)27-30(26-28)42-45(33-23-17-12-18-24-33)36(48)51-39(7,8)9/h10-27,40-42H,1-9H3 |
| InChIKey | HFZJCEWCRTWKQB-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|