C19H23NO2 — CID 165179795
tert-butyl N-[2-(cyclohexen-1-yl)ethynyl]-N-phenylcarbamate (PubChem CID 165179795) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl N-[2-(cyclohexen-1-yl)ethynyl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[2-(cyclohexen-1-yl)ethynyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 165179795 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl N-[2-(cyclohexen-1-yl)ethynyl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C#CC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-19(2,3)22-18(21)20(17-12-8-5-9-13-17)15-14-16-10-6-4-7-11-16/h5,8-10,12-13H,4,6-7,11H2,1-3H3 |
| InChIKey | CQOTUOPKZQTSGH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|