C22H29NO3S — CID 10667955
N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide (PubChem CID 10667955) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide.
| Compound Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10667955 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide |
| SMILES | CC(C)=CCCN([C@H](CO)Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-18(2)8-7-15-23(21(17-24)16-20-9-5-4-6-10-20)27(25,26)22-13-11-19(3)12-14-22/h4-6,8-14,21,24H,7,15-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | FBYQQHWEMDEPOL-NRFANRHFSA-N |
| XLogP | 3.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|