C26H36N2O2S — CID 10813020
N-[(2S)-1-benzylimino-4-methylpentan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide (PubChem CID 10813020) has the molecular formula C26H36N2O2S and a molecular weight of 440.65 g/mol. Its IUPAC name is N-[(2S)-1-benzylimino-4-methylpentan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide.
| Compound Name | N-[(2S)-1-benzylimino-4-methylpentan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10813020 |
| Molecular Formula | C26H36N2O2S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-[(2S)-1-benzylimino-4-methylpentan-2-yl]-4-methyl-N-(4-methylpent-3-enyl)benzenesulfonamide |
| SMILES | CC(C)=CCCN([C@H](/C=N/Cc1ccccc1)CC(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H36N2O2S/c1-21(2)10-9-17-28(31(29,30)26-15-13-23(5)14-16-26)25(18-22(3)4)20-27-19-24-11-7-6-8-12-24/h6-8,10-16,20,22,25H,9,17-19H2,1-5H3/b27-20+/t25-/m0/s1 |
| InChIKey | FLGKLEPNRKRIET-GICXXDNVSA-N |
| XLogP | 6.03 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|