C20H22NO4S- — CID 57373221
2-[(4-methylphenyl)sulfonyl-(2-methylprop-1-enyl)amino]-3-phenylpropanoate (PubChem CID 57373221) has the molecular formula C20H22NO4S- and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonyl-(2-methylprop-1-enyl)amino]-3-phenylpropanoate.
| Compound Name | 2-[(4-methylphenyl)sulfonyl-(2-methylprop-1-enyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 57373221 |
| Molecular Formula | C20H22NO4S- |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonyl-(2-methylprop-1-enyl)amino]-3-phenylpropanoate |
| SMILES | CC(C)=CN(C(Cc1ccccc1)C(=O)[O-])S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-15(2)14-21(26(24,25)18-11-9-16(3)10-12-18)19(20(22)23)13-17-7-5-4-6-8-17/h4-12,14,19H,13H2,1-3H3,(H,22,23)/p-1 |
| InChIKey | GCPMGLFFMXQTIM-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |