C23H23NO7S2 — CID 69075397
(2S)-2-[bis-(4-methylphenyl)sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 69075397) has the molecular formula C23H23NO7S2 and a molecular weight of 489.57 g/mol. Its IUPAC name is (2S)-2-[bis-(4-methylphenyl)sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[bis-(4-methylphenyl)sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 69075397 |
| Molecular Formula | C23H23NO7S2 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (2S)-2-[bis-(4-methylphenyl)sulfonylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N([C@@H](Cc2ccc(O)cc2)C(=O)O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23NO7S2/c1-16-3-11-20(12-4-16)32(28,29)24(33(30,31)21-13-5-17(2)6-14-21)22(23(26)27)15-18-7-9-19(25)10-8-18/h3-14,22,25H,15H2,1-2H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | AKDZOXFYHTWJFY-QFIPXVFZSA-N |
| XLogP | 3.08 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |