C18H20ClNO5S — CID 133241710
3-(3-chloro-4-methoxyphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 133241710) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 133241710 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)N(C)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C18H20ClNO5S/c1-12-4-7-14(8-5-12)26(23,24)20(2)16(18(21)22)11-13-6-9-17(25-3)15(19)10-13/h4-10,16H,11H2,1-3H3,(H,21,22) |
| InChIKey | VHBVUANVSFTLTF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |