C18H20ClNO4S — CID 100555513
(2S)-2-[(4-chlorophenyl)sulfonyl-methylamino]-3-(4-ethylphenyl)propanoic acid (PubChem CID 100555513) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)sulfonyl-methylamino]-3-(4-ethylphenyl)propanoic acid.
| Compound Name | (2S)-2-[(4-chlorophenyl)sulfonyl-methylamino]-3-(4-ethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100555513 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)sulfonyl-methylamino]-3-(4-ethylphenyl)propanoic acid |
| SMILES | CCc1ccc(C[C@@H](C(=O)O)N(C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-3-13-4-6-14(7-5-13)12-17(18(21)22)20(2)25(23,24)16-10-8-15(19)9-11-16/h4-11,17H,3,12H2,1-2H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | WFZOBUUCKKUUKR-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |