C16H16INO4S — CID 125045134
(2R)-2-[benzenesulfonyl(methyl)amino]-3-(4-iodophenyl)propanoic acid (PubChem CID 125045134) has the molecular formula C16H16INO4S and a molecular weight of 445.28 g/mol. Its IUPAC name is (2R)-2-[benzenesulfonyl(methyl)amino]-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2R)-2-[benzenesulfonyl(methyl)amino]-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 125045134 |
| Molecular Formula | C16H16INO4S |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | (2R)-2-[benzenesulfonyl(methyl)amino]-3-(4-iodophenyl)propanoic acid |
| SMILES | CN([C@H](Cc1ccc(I)cc1)C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16INO4S/c1-18(23(21,22)14-5-3-2-4-6-14)15(16(19)20)11-12-7-9-13(17)10-8-12/h2-10,15H,11H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | RVBUYLLYNQQVIT-OAHLLOKOSA-N |
| XLogP | 2.61 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|