C13H18INO2 — CID 100552636
(2R)-2-(diethylamino)-3-(4-iodophenyl)propanoic acid (PubChem CID 100552636) has the molecular formula C13H18INO2 and a molecular weight of 347.20 g/mol. Its IUPAC name is (2R)-2-(diethylamino)-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2R)-2-(diethylamino)-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 100552636 |
| Molecular Formula | C13H18INO2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (2R)-2-(diethylamino)-3-(4-iodophenyl)propanoic acid |
| SMILES | CCN(CC)[C@H](Cc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C13H18INO2/c1-3-15(4-2)12(13(16)17)9-10-5-7-11(14)8-6-10/h5-8,12H,3-4,9H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | LBFSAIRZUOWFMY-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|