C20H19NO4S — CID 19703222
2-[methyl(naphthalen-2-ylsulfonyl)amino]-3-phenylpropanoic acid (PubChem CID 19703222) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-[methyl(naphthalen-2-ylsulfonyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[methyl(naphthalen-2-ylsulfonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19703222 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[methyl(naphthalen-2-ylsulfonyl)amino]-3-phenylpropanoic acid |
| SMILES | CN(C(Cc1ccccc1)C(=O)O)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19NO4S/c1-21(19(20(22)23)13-15-7-3-2-4-8-15)26(24,25)18-12-11-16-9-5-6-10-17(16)14-18/h2-12,14,19H,13H2,1H3,(H,22,23) |
| InChIKey | LSVFUEBLCRKLFL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |