C17H16F3NO4S — CID 125045170
(2R)-2-[benzenesulfonyl(methyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 125045170) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is (2R)-2-[benzenesulfonyl(methyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-[benzenesulfonyl(methyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 125045170 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (2R)-2-[benzenesulfonyl(methyl)amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CN([C@H](Cc1cccc(C(F)(F)F)c1)C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16F3NO4S/c1-21(26(24,25)14-8-3-2-4-9-14)15(16(22)23)11-12-6-5-7-13(10-12)17(18,19)20/h2-10,15H,11H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | VWABHXUMQYHYFW-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |