C24H32N2O4S — CID 135033162
tert-butyl N-[(4-methylphenyl)sulfonyl-[(E)-6-phenylhex-3-en-2-yl]amino]carbamate (PubChem CID 135033162) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is tert-butyl N-[(4-methylphenyl)sulfonyl-[(E)-6-phenylhex-3-en-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[(4-methylphenyl)sulfonyl-[(E)-6-phenylhex-3-en-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 135033162 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | tert-butyl N-[(4-methylphenyl)sulfonyl-[(E)-6-phenylhex-3-en-2-yl]amino]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(NC(=O)OC(C)(C)C)C(C)/C=C/CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-19-15-17-22(18-16-19)31(28,29)26(25-23(27)30-24(3,4)5)20(2)11-9-10-14-21-12-7-6-8-13-21/h6-9,11-13,15-18,20H,10,14H2,1-5H3,(H,25,27)/b11-9+ |
| InChIKey | WNZXFAFNIWCYEJ-PKNBQFBNSA-N |
| XLogP | 5.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|