C21H27N3O6S — CID 101074327
tert-butyl N-[4-[benzyl-[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]sulfamoyl]phenyl]carbamate (PubChem CID 101074327) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is tert-butyl N-[4-[benzyl-[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]sulfamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[benzyl-[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 101074327 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | tert-butyl N-[4-[benzyl-[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]sulfamoyl]phenyl]carbamate |
| SMILES | C[C@@H](C(=O)NO)N(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O6S/c1-15(19(25)23-27)24(14-16-8-6-5-7-9-16)31(28,29)18-12-10-17(11-13-18)22-20(26)30-21(2,3)4/h5-13,15,27H,14H2,1-4H3,(H,22,26)(H,23,25)/t15-/m0/s1 |
| InChIKey | CUFRTYIAZVJNFI-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|