C27H32N2O4S — CID 17046233
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-tert-butylphenoxy)propanamide (PubChem CID 17046233) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-tert-butylphenoxy)propanamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-tert-butylphenoxy)propanamide |
|---|---|
| PubChem CID | 17046233 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-(4-tert-butylphenoxy)propanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O4S/c1-20(33-24-15-11-22(12-16-24)27(2,3)4)26(30)28-23-13-17-25(18-14-23)34(31,32)29(5)19-21-9-7-6-8-10-21/h6-18,20H,19H2,1-5H3,(H,28,30) |
| InChIKey | KVYYYEHVZNUPHR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |