C29H27ClN2O4S — CID 171152532
2-[benzenesulfonyl(benzyl)amino]-N-[4-[(4-chlorophenyl)methoxy]phenyl]propanamide (PubChem CID 171152532) has the molecular formula C29H27ClN2O4S and a molecular weight of 535.07 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[4-[(4-chlorophenyl)methoxy]phenyl]propanamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[4-[(4-chlorophenyl)methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 171152532 |
| Molecular Formula | C29H27ClN2O4S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[4-[(4-chlorophenyl)methoxy]phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(OCc2ccc(Cl)cc2)cc1)N(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27ClN2O4S/c1-22(32(20-23-8-4-2-5-9-23)37(34,35)28-10-6-3-7-11-28)29(33)31-26-16-18-27(19-17-26)36-21-24-12-14-25(30)15-13-24/h2-19,22H,20-21H2,1H3,(H,31,33) |
| InChIKey | RIHLTGQLBZMWLI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |