C21H31NO4 — CID 11728129
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z,2S)-5-phenylpent-3-en-2-yl]carbamate (PubChem CID 11728129) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z,2S)-5-phenylpent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z,2S)-5-phenylpent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 11728129 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z,2S)-5-phenylpent-3-en-2-yl]carbamate |
| SMILES | C[C@@H](/C=C\Cc1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO4/c1-16(12-11-15-17-13-9-8-10-14-17)22(18(23)25-20(2,3)4)19(24)26-21(5,6)7/h8-14,16H,15H2,1-7H3/b12-11-/t16-/m0/s1 |
| InChIKey | QZKDNBVKIDCKTL-JNSOCZORSA-N |
| XLogP | 5.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|