C24H37NO4S — CID 135006518
ethyl (E)-2-[hexylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenylpent-3-enoate (PubChem CID 135006518) has the molecular formula C24H37NO4S and a molecular weight of 435.63 g/mol. Its IUPAC name is ethyl (E)-2-[hexylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenylpent-3-enoate.
| Compound Name | ethyl (E)-2-[hexylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenylpent-3-enoate |
|---|---|
| PubChem CID | 135006518 |
| Molecular Formula | C24H37NO4S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl (E)-2-[hexylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-phenylpent-3-enoate |
| SMILES | CCCCCCSN(C(=O)OC(C)(C)C)C(/C=C/Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C24H37NO4S/c1-6-8-9-13-19-30-25(23(27)29-24(3,4)5)21(22(26)28-7-2)18-14-17-20-15-11-10-12-16-20/h10-12,14-16,18,21H,6-9,13,17,19H2,1-5H3/b18-14+ |
| InChIKey | UXIWMFNKKZYRDW-NBVRZTHBSA-N |
| XLogP | 6.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|