C27H37NO4 — CID 10048856
tert-butyl (2S)-2-[2-[benzyl(phenylmethoxy)amino]-2-oxoethyl]heptanoate (PubChem CID 10048856) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[benzyl(phenylmethoxy)amino]-2-oxoethyl]heptanoate.
| Compound Name | tert-butyl (2S)-2-[2-[benzyl(phenylmethoxy)amino]-2-oxoethyl]heptanoate |
|---|---|
| PubChem CID | 10048856 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | tert-butyl (2S)-2-[2-[benzyl(phenylmethoxy)amino]-2-oxoethyl]heptanoate |
| SMILES | CCCCC[C@@H](CC(=O)N(Cc1ccccc1)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H37NO4/c1-5-6-9-18-24(26(30)32-27(2,3)4)19-25(29)28(20-22-14-10-7-11-15-22)31-21-23-16-12-8-13-17-23/h7-8,10-17,24H,5-6,9,18-21H2,1-4H3/t24-/m0/s1 |
| InChIKey | INNQTYQMIPZWFC-DEOSSOPVSA-N |
| XLogP | 6.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|