C26H46N3O4+ — CID 52947307
trimethyl-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]octanoyl-phenylmethoxyamino]propyl]azanium (PubChem CID 52947307) has the molecular formula C26H46N3O4+ and a molecular weight of 464.67 g/mol. Its IUPAC name is trimethyl-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]octanoyl-phenylmethoxyamino]propyl]azanium.
| Compound Name | trimethyl-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]octanoyl-phenylmethoxyamino]propyl]azanium |
|---|---|
| PubChem CID | 52947307 |
| Molecular Formula | C26H46N3O4+ |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | trimethyl-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]octanoyl-phenylmethoxyamino]propyl]azanium |
| SMILES | CCCCCCC(NC(=O)OC(C)(C)C)C(=O)N(CCC[N+](C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C26H45N3O4/c1-8-9-10-14-18-23(27-25(31)33-26(2,3)4)24(30)28(19-15-20-29(5,6)7)32-21-22-16-12-11-13-17-22/h11-13,16-17,23H,8-10,14-15,18-21H2,1-7H3/p+1 |
| InChIKey | BGYGTFLXULVZBZ-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|