C27H31NO6S — CID 87297750
[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxyethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 87297750) has the molecular formula C27H31NO6S and a molecular weight of 497.61 g/mol. Its IUPAC name is [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxyethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxyethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87297750 |
| Molecular Formula | C27H31NO6S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxyethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2C(CNC(=O)OC(C)(C)C)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO6S/c1-20-14-16-22(17-15-20)35(30,31)34-24-13-9-8-12-23(24)25(18-28-26(29)33-27(2,3)4)32-19-21-10-6-5-7-11-21/h5-17,25H,18-19H2,1-4H3,(H,28,29) |
| InChIKey | GUMRWLTZMGHOTP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|