C24H31NO3 — CID 101155768
tert-butyl N-[(1S)-1-(4-methoxyphenyl)ethyl]-N-[(1R)-1-phenylbut-3-enyl]carbamate (PubChem CID 101155768) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-methoxyphenyl)ethyl]-N-[(1R)-1-phenylbut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-methoxyphenyl)ethyl]-N-[(1R)-1-phenylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 101155768 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-methoxyphenyl)ethyl]-N-[(1R)-1-phenylbut-3-enyl]carbamate |
| SMILES | C=CC[C@H](c1ccccc1)N(C(=O)OC(C)(C)C)[C@@H](C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-7-11-22(20-12-9-8-10-13-20)25(23(26)28-24(3,4)5)18(2)19-14-16-21(27-6)17-15-19/h7-10,12-18,22H,1,11H2,2-6H3/t18-,22+/m0/s1 |
| InChIKey | BITGFDIVTHBMCQ-PGRDOPGGSA-N |
| XLogP | 6.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|