C26H31NO3 — CID 11429643
tert-butyl N-(4-methoxyphenyl)-N-[(1Z,3R)-3-[(E)-2-phenylethenyl]hexa-1,5-dienyl]carbamate (PubChem CID 11429643) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-(4-methoxyphenyl)-N-[(1Z,3R)-3-[(E)-2-phenylethenyl]hexa-1,5-dienyl]carbamate.
| Compound Name | tert-butyl N-(4-methoxyphenyl)-N-[(1Z,3R)-3-[(E)-2-phenylethenyl]hexa-1,5-dienyl]carbamate |
|---|---|
| PubChem CID | 11429643 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | tert-butyl N-(4-methoxyphenyl)-N-[(1Z,3R)-3-[(E)-2-phenylethenyl]hexa-1,5-dienyl]carbamate |
| SMILES | C=CC[C@@H](/C=C\N(C(=O)OC(C)(C)C)c1ccc(OC)cc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H31NO3/c1-6-10-21(13-14-22-11-8-7-9-12-22)19-20-27(25(28)30-26(2,3)4)23-15-17-24(29-5)18-16-23/h6-9,11-21H,1,10H2,2-5H3/b14-13+,20-19-/t21-/m1/s1 |
| InChIKey | KEIXFFWDTBMGLZ-FVZSNAAPSA-N |
| XLogP | 6.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|