C24H35NO3 — CID 11783979
tert-butyl N-[(1E,3S)-3-cyclohexylhexa-1,5-dienyl]-N-(4-methoxyphenyl)carbamate (PubChem CID 11783979) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is tert-butyl N-[(1E,3S)-3-cyclohexylhexa-1,5-dienyl]-N-(4-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-[(1E,3S)-3-cyclohexylhexa-1,5-dienyl]-N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11783979 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl N-[(1E,3S)-3-cyclohexylhexa-1,5-dienyl]-N-(4-methoxyphenyl)carbamate |
| SMILES | C=CC[C@H](/C=C/N(C(=O)OC(C)(C)C)c1ccc(OC)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H35NO3/c1-6-10-19(20-11-8-7-9-12-20)17-18-25(23(26)28-24(2,3)4)21-13-15-22(27-5)16-14-21/h6,13-20H,1,7-12H2,2-5H3/b18-17+/t19-/m1/s1 |
| InChIKey | KTWAZJZWRXOKLI-ZELAZJAISA-N |
| XLogP | 6.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|