C24H29NO4 — CID 102091617
tert-butyl N-(4-methoxyphenyl)-N-[(R)-[(1R)-3-oxocyclopentyl]-phenylmethyl]carbamate (PubChem CID 102091617) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-(4-methoxyphenyl)-N-[(R)-[(1R)-3-oxocyclopentyl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-(4-methoxyphenyl)-N-[(R)-[(1R)-3-oxocyclopentyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 102091617 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | tert-butyl N-(4-methoxyphenyl)-N-[(R)-[(1R)-3-oxocyclopentyl]-phenylmethyl]carbamate |
| SMILES | COc1ccc(N(C(=O)OC(C)(C)C)[C@@H](c2ccccc2)[C@@H]2CCC(=O)C2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-24(2,3)29-23(27)25(19-11-14-21(28-4)15-12-19)22(17-8-6-5-7-9-17)18-10-13-20(26)16-18/h5-9,11-12,14-15,18,22H,10,13,16H2,1-4H3/t18-,22+/m1/s1 |
| InChIKey | CNPJZDSNSOESLI-GCJKJVERSA-N |
| XLogP | 5.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |