C26H28NO7P — CID 102422207
tert-butyl N-(1-diphenoxyphosphoryloxyethenyl)-N-(4-methoxyphenyl)carbamate (PubChem CID 102422207) has the molecular formula C26H28NO7P and a molecular weight of 497.48 g/mol. Its IUPAC name is tert-butyl N-(1-diphenoxyphosphoryloxyethenyl)-N-(4-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-(1-diphenoxyphosphoryloxyethenyl)-N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 102422207 |
| Molecular Formula | C26H28NO7P |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | tert-butyl N-(1-diphenoxyphosphoryloxyethenyl)-N-(4-methoxyphenyl)carbamate |
| SMILES | C=C(OP(=O)(Oc1ccccc1)Oc1ccccc1)N(C(=O)OC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H28NO7P/c1-20(27(25(28)31-26(2,3)4)21-16-18-22(30-5)19-17-21)32-35(29,33-23-12-8-6-9-13-23)34-24-14-10-7-11-15-24/h6-19H,1H2,2-5H3 |
| InChIKey | HBPBTCZQUZNFFB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|