C21H25NO5 — CID 10737969
methyl (2R)-2-[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-2-phenylacetate (PubChem CID 10737969) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is methyl (2R)-2-[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-2-phenylacetate |
|---|---|
| PubChem CID | 10737969 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl (2R)-2-[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](c1ccccc1)N(C(=O)OC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-21(2,3)27-20(24)22(16-11-13-17(25-4)14-12-16)18(19(23)26-5)15-9-7-6-8-10-15/h6-14,18H,1-5H3/t18-/m1/s1 |
| InChIKey | GACMJXIPWBAZGH-GOSISDBHSA-N |
| XLogP | 4.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |