C24H31NO4 — CID 135021424
tert-butyl N-[(1R)-2-hydroxy-4-methyl-1-phenylpent-3-enyl]-N-(4-methoxyphenyl)carbamate (PubChem CID 135021424) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-hydroxy-4-methyl-1-phenylpent-3-enyl]-N-(4-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-[(1R)-2-hydroxy-4-methyl-1-phenylpent-3-enyl]-N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 135021424 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl N-[(1R)-2-hydroxy-4-methyl-1-phenylpent-3-enyl]-N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(N(C(=O)OC(C)(C)C)[C@H](c2ccccc2)C(O)C=C(C)C)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-17(2)16-21(26)22(18-10-8-7-9-11-18)25(23(27)29-24(3,4)5)19-12-14-20(28-6)15-13-19/h7-16,21-22,26H,1-6H3/t21?,22-/m1/s1 |
| InChIKey | RZNFGJSPZSXXIZ-FOIFJWKZSA-N |
| XLogP | 5.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|