C32H41NO7 — CID 11786171
diethyl 2-[(S)-[(1S,2Z)-2-[[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]methylidene]cyclopentyl]-phenylmethyl]propanedioate (PubChem CID 11786171) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is diethyl 2-[(S)-[(1S,2Z)-2-[[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]methylidene]cyclopentyl]-phenylmethyl]propanedioate.
| Compound Name | diethyl 2-[(S)-[(1S,2Z)-2-[[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]methylidene]cyclopentyl]-phenylmethyl]propanedioate |
|---|---|
| PubChem CID | 11786171 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | diethyl 2-[(S)-[(1S,2Z)-2-[[4-methoxy-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]methylidene]cyclopentyl]-phenylmethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](c1ccccc1)[C@@H]1CCC/C1=C/N(C(=O)OC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H41NO7/c1-7-38-29(34)28(30(35)39-8-2)27(22-13-10-9-11-14-22)26-16-12-15-23(26)21-33(31(36)40-32(3,4)5)24-17-19-25(37-6)20-18-24/h9-11,13-14,17-21,26-28H,7-8,12,15-16H2,1-6H3/b23-21-/t26-,27+/m1/s1 |
| InChIKey | GOBCBGODLIDVBL-LLXKTYSLSA-N |
| XLogP | 6.65 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|