C25H32N2O6 — CID 24939595
tert-butyl N-[[(2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]cyclohexylidene]methyl]-N-(4-methoxyphenyl)carbamate (PubChem CID 24939595) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]cyclohexylidene]methyl]-N-(4-methoxyphenyl)carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]cyclohexylidene]methyl]-N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 24939595 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | tert-butyl N-[[(2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]cyclohexylidene]methyl]-N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(N(C=C2CCCC[C@H]2[C@@H](C[N+](=O)[O-])c2ccco2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O6/c1-25(2,3)33-24(28)26(19-11-13-20(31-4)14-12-19)16-18-8-5-6-9-21(18)22(17-27(29)30)23-10-7-15-32-23/h7,10-16,21-22H,5-6,8-9,17H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | FIDZCBKNBAGNKE-FGZHOGPDSA-N |
| XLogP | 6.16 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|