C15H18N2O6 — CID 101499858
tert-butyl (2R)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 101499858) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101499858 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | tert-butyl (2R)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C=C[C@@H]1[C@H](C[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C15H18N2O6/c1-15(2,3)23-14(19)17-11(6-7-13(17)18)10(9-16(20)21)12-5-4-8-22-12/h4-8,10-11H,9H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | UMJGIQGNXFOTJD-WDEREUQCSA-N |
| XLogP | 2.34 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|