C20H21NO4 — CID 102297484
tert-butyl (2S)-2-[(S)-hydroxy(naphthalen-2-yl)methyl]-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 102297484) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(S)-hydroxy(naphthalen-2-yl)methyl]-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(S)-hydroxy(naphthalen-2-yl)methyl]-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102297484 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl (2S)-2-[(S)-hydroxy(naphthalen-2-yl)methyl]-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C=C[C@H]1[C@@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H21NO4/c1-20(2,3)25-19(24)21-16(10-11-17(21)22)18(23)15-9-8-13-6-4-5-7-14(13)12-15/h4-12,16,18,23H,1-3H3/t16-,18-/m0/s1 |
| InChIKey | SGOAPIINBINWKY-WMZOPIPTSA-N |
| XLogP | 3.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |