C34H40N2O4S — CID 10166888
tert-butyl (2R)-2-[(1R,2S)-2-methoxy-2-methyl-1-(tritylsulfanylamino)butyl]-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 10166888) has the molecular formula C34H40N2O4S and a molecular weight of 572.77 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1R,2S)-2-methoxy-2-methyl-1-(tritylsulfanylamino)butyl]-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1R,2S)-2-methoxy-2-methyl-1-(tritylsulfanylamino)butyl]-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10166888 |
| Molecular Formula | C34H40N2O4S |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | tert-butyl (2R)-2-[(1R,2S)-2-methoxy-2-methyl-1-(tritylsulfanylamino)butyl]-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CC[C@](C)(OC)[C@H](NSC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H40N2O4S/c1-7-33(5,39-6)30(28-23-24-29(37)36(28)31(38)40-32(2,3)4)35-41-34(25-17-11-8-12-18-25,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h8-24,28,30,35H,7H2,1-6H3/t28-,30-,33+/m1/s1 |
| InChIKey | QLUYIBUCYWCINR-DBZLJLCCSA-N |
| XLogP | 7.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|