C23H34N2O5 — CID 158274985
tert-butyl (2R)-2-[(1S,2R)-2-methoxy-1-(4-methoxyanilino)-2-methylpentyl]-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 158274985) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S,2R)-2-methoxy-1-(4-methoxyanilino)-2-methylpentyl]-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S,2R)-2-methoxy-1-(4-methoxyanilino)-2-methylpentyl]-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 158274985 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | tert-butyl (2R)-2-[(1S,2R)-2-methoxy-1-(4-methoxyanilino)-2-methylpentyl]-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | CCC[C@@](C)(OC)[C@@H](Nc1ccc(OC)cc1)[C@H]1C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N2O5/c1-8-15-23(5,29-7)20(24-16-9-11-17(28-6)12-10-16)18-13-14-19(26)25(18)21(27)30-22(2,3)4/h9-14,18,20,24H,8,15H2,1-7H3/t18-,20+,23-/m1/s1 |
| InChIKey | YYHLXAUCRSTQHR-QMHWCDLVSA-N |
| XLogP | 4.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|