C21H25NO7 — CID 102450873
dimethyl 2-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2H-pyrrol-2-yl]-phenylmethyl]propanedioate (PubChem CID 102450873) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is dimethyl 2-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2H-pyrrol-2-yl]-phenylmethyl]propanedioate.
| Compound Name | dimethyl 2-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2H-pyrrol-2-yl]-phenylmethyl]propanedioate |
|---|---|
| PubChem CID | 102450873 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | dimethyl 2-[(S)-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxo-2H-pyrrol-2-yl]-phenylmethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](c1ccccc1)[C@@H]1C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25NO7/c1-21(2,3)29-20(26)22-14(11-12-15(22)23)16(13-9-7-6-8-10-13)17(18(24)27-4)19(25)28-5/h6-12,14,16-17H,1-5H3/t14-,16-/m0/s1 |
| InChIKey | QBLYXUUWYNDXBL-HOCLYGCPSA-N |
| XLogP | 2.43 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|