C11H17NO4 — CID 10036680
tert-butyl (2S)-2-(methoxymethyl)-5-oxo-2H-pyrrole-1-carboxylate (PubChem CID 10036680) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl (2S)-2-(methoxymethyl)-5-oxo-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(methoxymethyl)-5-oxo-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10036680 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | tert-butyl (2S)-2-(methoxymethyl)-5-oxo-2H-pyrrole-1-carboxylate |
| SMILES | COC[C@@H]1C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(14)12-8(7-15-4)5-6-9(12)13/h5-6,8H,7H2,1-4H3/t8-/m0/s1 |
| InChIKey | YSZLHGSUSLRNAV-QMMMGPOBSA-N |
| XLogP | 1.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |