C25H26N2O5 — CID 135027694
tert-butyl (2S)-2-(benzhydrylideneamino)-3-(furan-2-yl)-4-nitrobutanoate (PubChem CID 135027694) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-(furan-2-yl)-4-nitrobutanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(furan-2-yl)-4-nitrobutanoate |
|---|---|
| PubChem CID | 135027694 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(furan-2-yl)-4-nitrobutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)C(C[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C25H26N2O5/c1-25(2,3)32-24(28)23(20(17-27(29)30)21-15-10-16-31-21)26-22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-16,20,23H,17H2,1-3H3/t20?,23-/m0/s1 |
| InChIKey | MXUNILHOZXXBDP-AKRCKQFNSA-N |
| XLogP | 4.89 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|