C16H14FNO5 — CID 142751403
(2S)-2-fluoro-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-1-phenylbutane-1,3-dione (PubChem CID 142751403) has the molecular formula C16H14FNO5 and a molecular weight of 319.29 g/mol. Its IUPAC name is (2S)-2-fluoro-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-1-phenylbutane-1,3-dione.
| Compound Name | (2S)-2-fluoro-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 142751403 |
| Molecular Formula | C16H14FNO5 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2S)-2-fluoro-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)[C@](F)(C(=O)c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C16H14FNO5/c1-11(19)16(17,15(20)12-6-3-2-4-7-12)13(10-18(21)22)14-8-5-9-23-14/h2-9,13H,10H2,1H3/t13-,16+/m0/s1 |
| InChIKey | WIZCMPKGXYOMFR-XJKSGUPXSA-N |
| XLogP | 2.82 |
| TPSA | 90.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|