C25H21F3N2O4 — CID 102488145
methyl (2S,3S)-2-(benzhydrylideneamino)-4-nitro-3-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 102488145) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzhydrylideneamino)-4-nitro-3-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl (2S,3S)-2-(benzhydrylideneamino)-4-nitro-3-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 102488145 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl (2S,3S)-2-(benzhydrylideneamino)-4-nitro-3-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F3N2O4/c1-34-24(31)23(21(16-30(32)33)17-12-14-20(15-13-17)25(26,27)28)29-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | KNMZLWIUYPNUTA-GGAORHGYSA-N |
| XLogP | 5.14 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|