C20H18F3NO4 — CID 72836797
2-[(1S)-2-nitro-1-phenylethyl]-1-[3-(trifluoromethyl)phenyl]pentane-1,3-dione (PubChem CID 72836797) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-[(1S)-2-nitro-1-phenylethyl]-1-[3-(trifluoromethyl)phenyl]pentane-1,3-dione.
| Compound Name | 2-[(1S)-2-nitro-1-phenylethyl]-1-[3-(trifluoromethyl)phenyl]pentane-1,3-dione |
|---|---|
| PubChem CID | 72836797 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(1S)-2-nitro-1-phenylethyl]-1-[3-(trifluoromethyl)phenyl]pentane-1,3-dione |
| SMILES | CCC(=O)C(C(=O)c1cccc(C(F)(F)F)c1)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H18F3NO4/c1-2-17(25)18(16(12-24(27)28)13-7-4-3-5-8-13)19(26)14-9-6-10-15(11-14)20(21,22)23/h3-11,16,18H,2,12H2,1H3/t16-,18?/m1/s1 |
| InChIKey | NSYNLOVXHXCNBH-PYUWXLGESA-N |
| XLogP | 4.54 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|