C22H24F3NO4 — CID 152740064
dimethyl 2-[(1S)-2-[benzyl(methyl)amino]-1-[4-(trifluoromethyl)phenyl]ethyl]propanedioate (PubChem CID 152740064) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is dimethyl 2-[(1S)-2-[benzyl(methyl)amino]-1-[4-(trifluoromethyl)phenyl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[(1S)-2-[benzyl(methyl)amino]-1-[4-(trifluoromethyl)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 152740064 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | dimethyl 2-[(1S)-2-[benzyl(methyl)amino]-1-[4-(trifluoromethyl)phenyl]ethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](CN(C)Cc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H24F3NO4/c1-26(13-15-7-5-4-6-8-15)14-18(19(20(27)29-2)21(28)30-3)16-9-11-17(12-10-16)22(23,24)25/h4-12,18-19H,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | ZZKTXMQSIGCSHD-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|