C16H19FN2 — CID 18070991
N'-benzyl-1-(4-fluorophenyl)-N'-methylethane-1,2-diamine (PubChem CID 18070991) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is N'-benzyl-1-(4-fluorophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-benzyl-1-(4-fluorophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 18070991 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N'-benzyl-1-(4-fluorophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(Cc1ccccc1)CC(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2/c1-19(11-13-5-3-2-4-6-13)12-16(18)14-7-9-15(17)10-8-14/h2-10,16H,11-12,18H2,1H3 |
| InChIKey | OCKXXRDDTFAGKE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |