C18H24N2O8 — CID 132568265
1-O-tert-butyl 2-O-ethyl (2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-3-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 132568265) has the molecular formula C18H24N2O8 and a molecular weight of 396.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-3-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-3-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 132568265 |
| Molecular Formula | C18H24N2O8 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S)-2-[(1S)-1-(furan-2-yl)-2-nitroethyl]-3-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@]1([C@H](C[N+](=O)[O-])c2ccco2)C(=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O8/c1-5-26-15(22)18(12(11-20(24)25)13-7-6-10-27-13)14(21)8-9-19(18)16(23)28-17(2,3)4/h6-7,10,12H,5,8-9,11H2,1-4H3/t12-,18+/m1/s1 |
| InChIKey | DEGCFUDTRWZGFR-XIKOKIGWSA-N |
| XLogP | 2.15 |
| TPSA | 129.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|