C16H14FN3O4 — CID 102306017
(4S)-4-fluoro-4-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 102306017) has the molecular formula C16H14FN3O4 and a molecular weight of 331.30 g/mol. Its IUPAC name is (4S)-4-fluoro-4-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4S)-4-fluoro-4-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 102306017 |
| Molecular Formula | C16H14FN3O4 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4S)-4-fluoro-4-[(1S)-1-(furan-2-yl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@]1(F)[C@@H](C[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C16H14FN3O4/c1-11-16(17,13(10-19(22)23)14-8-5-9-24-14)15(21)20(18-11)12-6-3-2-4-7-12/h2-9,13H,10H2,1H3/t13-,16+/m0/s1 |
| InChIKey | KHFBEQKPAXEPNP-XJKSGUPXSA-N |
| XLogP | 2.77 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|