C19H18BrN3O4 — CID 102435891
(4R)-4-bromo-4-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 102435891) has the molecular formula C19H18BrN3O4 and a molecular weight of 432.27 g/mol. Its IUPAC name is (4R)-4-bromo-4-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4R)-4-bromo-4-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 102435891 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (4R)-4-bromo-4-[(1R)-1-(3-methoxyphenyl)-2-nitroethyl]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cccc([C@H](C[N+](=O)[O-])[C@]2(Br)C(=O)N(c3ccccc3)N=C2C)c1 |
| InChI | InChI=1S/C19H18BrN3O4/c1-13-19(20,18(24)23(21-13)15-8-4-3-5-9-15)17(12-22(25)26)14-7-6-10-16(11-14)27-2/h3-11,17H,12H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | ZYFZZYSSYDKNJB-HKUYNNGSSA-N |
| XLogP | 3.61 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|