C11H14N2O5 — CID 177471411
1-[(2S,3S)-1,3-dinitrobutan-2-yl]-3-methoxybenzene (PubChem CID 177471411) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 1-[(2S,3S)-1,3-dinitrobutan-2-yl]-3-methoxybenzene.
| Compound Name | 1-[(2S,3S)-1,3-dinitrobutan-2-yl]-3-methoxybenzene |
|---|---|
| PubChem CID | 177471411 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-[(2S,3S)-1,3-dinitrobutan-2-yl]-3-methoxybenzene |
| SMILES | COc1cccc([C@@H](C[N+](=O)[O-])[C@H](C)[N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N2O5/c1-8(13(16)17)11(7-12(14)15)9-4-3-5-10(6-9)18-2/h3-6,8,11H,7H2,1-2H3/t8-,11-/m0/s1 |
| InChIKey | OFVJBYWOTZVRMB-KWQFWETISA-N |
| XLogP | 1.72 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|