C17H19NO5 — CID 57381128
1,2-dimethoxy-4-[(1S)-1-(3-methoxyphenyl)-2-nitroethyl]benzene (PubChem CID 57381128) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(1S)-1-(3-methoxyphenyl)-2-nitroethyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(1S)-1-(3-methoxyphenyl)-2-nitroethyl]benzene |
|---|---|
| PubChem CID | 57381128 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1,2-dimethoxy-4-[(1S)-1-(3-methoxyphenyl)-2-nitroethyl]benzene |
| SMILES | COc1cccc([C@H](C[N+](=O)[O-])c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H19NO5/c1-21-14-6-4-5-12(9-14)15(11-18(19)20)13-7-8-16(22-2)17(10-13)23-3/h4-10,15H,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | HSDIGZSUYSNDBL-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|