C14H18N6O4 — CID 177380622
5-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]pyrimidine-2,4,6-triamine (PubChem CID 177380622) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is 5-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]pyrimidine-2,4,6-triamine.
| Compound Name | 5-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 177380622 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccc(C(C[N+](=O)[O-])c2c(N)nc(N)nc2N)cc1OC |
| InChI | InChI=1S/C14H18N6O4/c1-23-9-4-3-7(5-10(9)24-2)8(6-20(21)22)11-12(15)18-14(17)19-13(11)16/h3-5,8H,6H2,1-2H3,(H6,15,16,17,18,19) |
| InChIKey | GGZXPRGUAFKRJB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 165.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|